C24H23N3O2 — CID 176729799
3-[[[4-(dimethylamino)phenyl]-(2-hydroxynaphthalen-1-yl)methyl]amino]-1H-pyridin-4-one (PubChem CID 176729799) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 3-[[[4-(dimethylamino)phenyl]-(2-hydroxynaphthalen-1-yl)methyl]amino]-1H-pyridin-4-one.
| Compound Name | 3-[[[4-(dimethylamino)phenyl]-(2-hydroxynaphthalen-1-yl)methyl]amino]-1H-pyridin-4-one |
|---|---|
| PubChem CID | 176729799 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 3-[[[4-(dimethylamino)phenyl]-(2-hydroxynaphthalen-1-yl)methyl]amino]-1H-pyridin-4-one |
| SMILES | CN(C)c1ccc(C(Nc2c[nH]ccc2=O)c2c(O)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C24H23N3O2/c1-27(2)18-10-7-17(8-11-18)24(26-20-15-25-14-13-21(20)28)23-19-6-4-3-5-16(19)9-12-22(23)29/h3-15,24,26,29H,1-2H3,(H,25,28) |
| InChIKey | CDQRMUJQDAAWSJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|