C27H34IN9O4 — CID 176736787
2-[4-[[6-(azidomethyl)-2-pyridinyl]methyl]-7-(carboxymethyl)-10-[[6-(2-iodoethynyl)-2-pyridinyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 176736787) has the molecular formula C27H34IN9O4 and a molecular weight of 675.53 g/mol. Its IUPAC name is 2-[4-[[6-(azidomethyl)-2-pyridinyl]methyl]-7-(carboxymethyl)-10-[[6-(2-iodoethynyl)-2-pyridinyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4-[[6-(azidomethyl)-2-pyridinyl]methyl]-7-(carboxymethyl)-10-[[6-(2-iodoethynyl)-2-pyridinyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 176736787 |
| Molecular Formula | C27H34IN9O4 |
| Molecular Weight | 675.53 g/mol |
| Exact Mass | 675.18 |
| IUPAC Name | 2-[4-[[6-(azidomethyl)-2-pyridinyl]methyl]-7-(carboxymethyl)-10-[[6-(2-iodoethynyl)-2-pyridinyl]methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | [N-]=[N+]=NCc1cccc(CN2CCN(CC(=O)O)CCN(Cc3cccc(C#CI)n3)CCN(CC(=O)O)CC2)n1 |
| InChI | InChI=1S/C27H34IN9O4/c28-8-7-22-3-1-5-24(31-22)18-34-9-13-36(20-26(38)39)15-11-35(12-16-37(14-10-34)21-27(40)41)19-25-6-2-4-23(32-25)17-30-33-29/h1-6H,9-21H2,(H,38,39)(H,40,41) |
| InChIKey | AFISMWAFAYCBFK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 162.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.53 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|