C34H42N10O4 — CID 176736811
2-[4-[[6-(3-aminoprop-1-ynyl)-2-pyridinyl]methyl]-10-[[6-(azidomethyl)-4-phenyl-2-pyridinyl]methyl]-7-(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 176736811) has the molecular formula C34H42N10O4 and a molecular weight of 654.78 g/mol. Its IUPAC name is 2-[4-[[6-(3-aminoprop-1-ynyl)-2-pyridinyl]methyl]-10-[[6-(azidomethyl)-4-phenyl-2-pyridinyl]methyl]-7-(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4-[[6-(3-aminoprop-1-ynyl)-2-pyridinyl]methyl]-10-[[6-(azidomethyl)-4-phenyl-2-pyridinyl]methyl]-7-(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 176736811 |
| Molecular Formula | C34H42N10O4 |
| Molecular Weight | 654.78 g/mol |
| Exact Mass | 654.34 |
| IUPAC Name | 2-[4-[[6-(3-aminoprop-1-ynyl)-2-pyridinyl]methyl]-10-[[6-(azidomethyl)-4-phenyl-2-pyridinyl]methyl]-7-(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | [N-]=[N+]=NCc1cc(-c2ccccc2)cc(CN2CCN(CC(=O)O)CCN(Cc3cccc(C#CCN)n3)CCN(CC(=O)O)CC2)n1 |
| InChI | InChI=1S/C34H42N10O4/c35-11-5-10-29-8-4-9-30(38-29)23-41-12-16-43(25-33(45)46)18-14-42(15-19-44(17-13-41)26-34(47)48)24-32-21-28(27-6-2-1-3-7-27)20-31(39-32)22-37-40-36/h1-4,6-9,20-21H,11-19,22-26,35H2,(H,45,46)(H,47,48) |
| InChIKey | BKXUMZWAPQFIFT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 188.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.78 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|