C21H23FO2 — CID 176739878
2-(7-fluoro-3-methyl-8-prop-1-ynylnaphthalen-1-yl)-4,4,5,5-tetramethyl-1,3-dioxolane (PubChem CID 176739878) has the molecular formula C21H23FO2 and a molecular weight of 326.41 g/mol. Its IUPAC name is 2-(7-fluoro-3-methyl-8-prop-1-ynylnaphthalen-1-yl)-4,4,5,5-tetramethyl-1,3-dioxolane.
| Compound Name | 2-(7-fluoro-3-methyl-8-prop-1-ynylnaphthalen-1-yl)-4,4,5,5-tetramethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 176739878 |
| Molecular Formula | C21H23FO2 |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 2-(7-fluoro-3-methyl-8-prop-1-ynylnaphthalen-1-yl)-4,4,5,5-tetramethyl-1,3-dioxolane |
| SMILES | CC#Cc1c(F)ccc2cc(C)cc(C3OC(C)(C)C(C)(C)O3)c12 |
| InChI | InChI=1S/C21H23FO2/c1-7-8-15-17(22)10-9-14-11-13(2)12-16(18(14)15)19-23-20(3,4)21(5,6)24-19/h9-12,19H,1-6H3 |
| InChIKey | SRGJULKEIJXVQQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|