C20H15F3N2O3 — CID 176741228
3-acetyl-N-methyl-2-oxo-1-[4-(trifluoromethyl)phenyl]quinoline-6-carboxamide (PubChem CID 176741228) has the molecular formula C20H15F3N2O3 and a molecular weight of 388.35 g/mol. Its IUPAC name is 3-acetyl-N-methyl-2-oxo-1-[4-(trifluoromethyl)phenyl]quinoline-6-carboxamide.
| Compound Name | 3-acetyl-N-methyl-2-oxo-1-[4-(trifluoromethyl)phenyl]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 176741228 |
| Molecular Formula | C20H15F3N2O3 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 3-acetyl-N-methyl-2-oxo-1-[4-(trifluoromethyl)phenyl]quinoline-6-carboxamide |
| SMILES | CNC(=O)c1ccc2c(c1)cc(C(C)=O)c(=O)n2-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H15F3N2O3/c1-11(26)16-10-13-9-12(18(27)24-2)3-8-17(13)25(19(16)28)15-6-4-14(5-7-15)20(21,22)23/h3-10H,1-2H3,(H,24,27) |
| InChIKey | NIHJAEJWJFRONU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |