About sodium;7-tert-butyl-2-(2-methanidylpropyl)-2-azaspiro[3.5]nonane;2-methylpropane
sodium;7-tert-butyl-2-(2-methanidylpropyl)-2-azaspiro[3.5]nonane;2-methylpropane (PubChem CID 176741795) has the molecular formula C20H38NNa-2
and a molecular weight of 315.52 g/mol. Its IUPAC name is sodium;7-tert-butyl-2-(2-methanidylpropyl)-2-azaspiro[3.5]nonane;2-methylpropane.
Molecular Properties
| Compound Name | sodium;7-tert-butyl-2-(2-methanidylpropyl)-2-azaspiro[3.5]nonane;2-methylpropane |
| PubChem CID | 176741795 |
| Molecular Formula | C20H38NNa-2 |
| Molecular Weight | 315.52 g/mol |
| Exact Mass | 315.29 |
| IUPAC Name | sodium;7-tert-butyl-2-(2-methanidylpropyl)-2-azaspiro[3.5]nonane;2-methylpropane |
| SMILES | C[C-](C)C.[CH2-]C([CH2-])CN1CC2(CCC(C(C)(C)C)CC2)C1.[Na+] |
| InChI | InChI=1S/C16H29N.C4H9.Na/c1-13(2)10-17-11-16(12-17)8-6-14(7-9-16)15(3,4)5;1-4(2)3;/h13-14H,1-2,6-12H2,3-5H3;1-3H3;/q-2;-1;+1 |
| InChIKey | WSMFMYZMSHNXSQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.52 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium;7-tert-butyl-2-(2-methanidylpropyl)-2-azaspiro[3.5]nonane;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;7-tert-butyl-2-(2-methanidylpropyl)-2-azaspiro[3.5]nonane;2-methylpropane?
The IUPAC name of sodium;7-tert-butyl-2-(2-methanidylpropyl)-2-azaspiro[3.5]nonane;2-methylpropane (CID 176741795) is sodium;7-tert-butyl-2-(2-methanidylpropyl)-2-azaspiro[3.5]nonane;2-methylpropane.
What is the SMILES notation for sodium;7-tert-butyl-2-(2-methanidylpropyl)-2-azaspiro[3.5]nonane;2-methylpropane?
The canonical SMILES for sodium;7-tert-butyl-2-(2-methanidylpropyl)-2-azaspiro[3.5]nonane;2-methylpropane is C[C-](C)C.[CH2-]C([CH2-])CN1CC2(CCC(C(C)(C)C)CC2)C1.[Na+].
What is the InChIKey of sodium;7-tert-butyl-2-(2-methanidylpropyl)-2-azaspiro[3.5]nonane;2-methylpropane?
The InChIKey is WSMFMYZMSHNXSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29N.C4H9.Na/c1-13(2)10-17-11-16(12-17)8-6-14(7-9-16)15(3,4)5;1-4(2)3;/h13-14H,1-2,6-12H2,3-5H3;1-3H3;/q-2;-1;+1.
What are the key properties of sodium;7-tert-butyl-2-(2-methanidylpropyl)-2-azaspiro[3.5]nonane;2-methylpropane?
sodium;7-tert-butyl-2-(2-methanidylpropyl)-2-azaspiro[3.5]nonane;2-methylpropane has a molecular weight of 315.52 g/mol, XLogP of 2.43, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;7-tert-butyl-2-(2-methanidylpropyl)-2-azaspiro[3.5]nonane;2-methylpropane is sourced from PubChem (CID 176741795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).