C22H29F3N2O5 — CID 176748802
3-[2-[[(5S,7S)-3-hydroxy-1-adamantyl]-(2,2,2-trifluoroacetyl)amino]acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid (PubChem CID 176748802) has the molecular formula C22H29F3N2O5 and a molecular weight of 458.48 g/mol. Its IUPAC name is 3-[2-[[(5S,7S)-3-hydroxy-1-adamantyl]-(2,2,2-trifluoroacetyl)amino]acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid.
| Compound Name | 3-[2-[[(5S,7S)-3-hydroxy-1-adamantyl]-(2,2,2-trifluoroacetyl)amino]acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
|---|---|
| PubChem CID | 176748802 |
| Molecular Formula | C22H29F3N2O5 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 3-[2-[[(5S,7S)-3-hydroxy-1-adamantyl]-(2,2,2-trifluoroacetyl)amino]acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
| SMILES | CC1(C)C2CN(C(=O)CN(C(=O)C(F)(F)F)C34C[C@@H]5C[C@H](CC(O)(C5)C3)C4)C(C(=O)O)C21 |
| InChI | InChI=1S/C22H29F3N2O5/c1-19(2)13-8-26(16(15(13)19)17(29)30)14(28)9-27(18(31)22(23,24)25)20-4-11-3-12(5-20)7-21(32,6-11)10-20/h11-13,15-16,32H,3-10H2,1-2H3,(H,29,30)/t11-,12-,13?,15?,16?,20?,21?/m0/s1 |
| InChIKey | SEBCPUTUFFRLRD-PXZJPKOSSA-N |
| XLogP | 2.03 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |