C35H31IO12S — CID 176750846
2-hydroxy-4-[2-[16-[2-(3-iodo-4-sulfophenoxy)ethoxycarbonyl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,10,12-pentaene-15-carbonyl]oxyethoxy]benzoic acid (PubChem CID 176750846) has the molecular formula C35H31IO12S and a molecular weight of 802.59 g/mol. Its IUPAC name is 2-hydroxy-4-[2-[16-[2-(3-iodo-4-sulfophenoxy)ethoxycarbonyl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,10,12-pentaene-15-carbonyl]oxyethoxy]benzoic acid.
| Compound Name | 2-hydroxy-4-[2-[16-[2-(3-iodo-4-sulfophenoxy)ethoxycarbonyl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,10,12-pentaene-15-carbonyl]oxyethoxy]benzoic acid |
|---|---|
| PubChem CID | 176750846 |
| Molecular Formula | C35H31IO12S |
| Molecular Weight | 802.59 g/mol |
| Exact Mass | 802.06 |
| IUPAC Name | 2-hydroxy-4-[2-[16-[2-(3-iodo-4-sulfophenoxy)ethoxycarbonyl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,10,12-pentaene-15-carbonyl]oxyethoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OCCOC(=O)C2C(C(=O)OCCOc3ccc(S(=O)(=O)O)c(I)c3)C3c4ccccc4C2C2C=CC=CC23)cc1O |
| InChI | InChI=1S/C35H31IO12S/c36-26-17-19(10-12-28(26)49(42,43)44)45-13-15-47-34(40)31-29-21-5-1-3-7-23(21)30(24-8-4-2-6-22(24)29)32(31)35(41)48-16-14-46-20-9-11-25(33(38)39)27(37)18-20/h1-12,17-18,21,23,29-32,37H,13-16H2,(H,38,39)(H,42,43,44) |
| InChIKey | CVTVABBOEAQTDI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 182.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.59 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|