C37H35IrN2O3- — CID 176757130
5-[4-[(6-tert-butylnaphthalen-2-yl)methyl]-2-pyridinyl]-7-methyl-4H-furo[3,2-h]quinolin-4-ide;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 176757130) has the molecular formula C37H35IrN2O3- and a molecular weight of 747.92 g/mol. Its IUPAC name is 5-[4-[(6-tert-butylnaphthalen-2-yl)methyl]-2-pyridinyl]-7-methyl-4H-furo[3,2-h]quinolin-4-ide;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 5-[4-[(6-tert-butylnaphthalen-2-yl)methyl]-2-pyridinyl]-7-methyl-4H-furo[3,2-h]quinolin-4-ide;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 176757130 |
| Molecular Formula | C37H35IrN2O3- |
| Molecular Weight | 747.92 g/mol |
| Exact Mass | 748.23 |
| IUPAC Name | 5-[4-[(6-tert-butylnaphthalen-2-yl)methyl]-2-pyridinyl]-7-methyl-4H-furo[3,2-h]quinolin-4-ide;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.Cc1cnc2c(c1)c(-c1cc(Cc3ccc4cc(C(C)(C)C)ccc4c3)ccn1)[c-]c1ccoc12.[Ir] |
| InChI | InChI=1S/C32H27N2O.C5H8O2.Ir/c1-20-13-28-27(18-25-10-12-35-31(25)30(28)34-19-20)29-16-22(9-11-33-29)14-21-5-6-24-17-26(32(2,3)4)8-7-23(24)15-21;1-4(6)3-5(2)7;/h5-13,15-17,19H,14H2,1-4H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | FMDXZHMBGVILJM-LWFKIUJUSA-N |
| XLogP | 9.23 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.92 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|