C31H21Cl — CID 176759908
9-(3-chlorophenyl)-9-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]fluorene (PubChem CID 176759908) has the molecular formula C31H21Cl and a molecular weight of 433.99 g/mol. Its IUPAC name is 9-(3-chlorophenyl)-9-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]fluorene.
| Compound Name | 9-(3-chlorophenyl)-9-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]fluorene |
|---|---|
| PubChem CID | 176759908 |
| Molecular Formula | C31H21Cl |
| Molecular Weight | 433.99 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 9-(3-chlorophenyl)-9-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]fluorene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(C3(c4cccc(Cl)c4)c4ccccc4-c4ccccc43)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C31H21Cl/c32-26-12-8-11-25(21-26)31(24-19-17-23(18-20-24)22-9-2-1-3-10-22)29-15-6-4-13-27(29)28-14-5-7-16-30(28)31/h1-21H/i1D,2D,3D,9D,10D |
| InChIKey | MOKCHGYQUCIYFE-MYWHSQMISA-N |
| XLogP | 8.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.99 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |