C22H43FN4 — CID 176760614
1-[[1-(1-tert-butyl-3-fluoropiperidin-4-yl)piperidin-4-yl]methyl]-4-propan-2-ylpiperazine (PubChem CID 176760614) has the molecular formula C22H43FN4 and a molecular weight of 382.61 g/mol. Its IUPAC name is 1-[[1-(1-tert-butyl-3-fluoropiperidin-4-yl)piperidin-4-yl]methyl]-4-propan-2-ylpiperazine.
| Compound Name | 1-[[1-(1-tert-butyl-3-fluoropiperidin-4-yl)piperidin-4-yl]methyl]-4-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 176760614 |
| Molecular Formula | C22H43FN4 |
| Molecular Weight | 382.61 g/mol |
| Exact Mass | 382.35 |
| IUPAC Name | 1-[[1-(1-tert-butyl-3-fluoropiperidin-4-yl)piperidin-4-yl]methyl]-4-propan-2-ylpiperazine |
| SMILES | CC(C)N1CCN(CC2CCN(C3CCN(C(C)(C)C)CC3F)CC2)CC1 |
| InChI | InChI=1S/C22H43FN4/c1-18(2)25-14-12-24(13-15-25)16-19-6-9-26(10-7-19)21-8-11-27(17-20(21)23)22(3,4)5/h18-21H,6-17H2,1-5H3 |
| InChIKey | VCFKSDUSFAYGDS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.61 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |