C42H38N2 — CID 176762852
13-isocyano-6-[2,4,6-tri(propan-2-yl)phenyl]-10-azaheptacyclo[13.6.6.02,14.03,11.04,9.016,21.022,27]heptacosa-2,4(9),5,7,11,13,16,18,20,22,24,26-dodecaene (PubChem CID 176762852) has the molecular formula C42H38N2 and a molecular weight of 570.78 g/mol. Its IUPAC name is 13-isocyano-6-[2,4,6-tri(propan-2-yl)phenyl]-10-azaheptacyclo[13.6.6.02,14.03,11.04,9.016,21.022,27]heptacosa-2,4(9),5,7,11,13,16,18,20,22,24,26-dodecaene.
| Compound Name | 13-isocyano-6-[2,4,6-tri(propan-2-yl)phenyl]-10-azaheptacyclo[13.6.6.02,14.03,11.04,9.016,21.022,27]heptacosa-2,4(9),5,7,11,13,16,18,20,22,24,26-dodecaene |
|---|---|
| PubChem CID | 176762852 |
| Molecular Formula | C42H38N2 |
| Molecular Weight | 570.78 g/mol |
| Exact Mass | 570.30 |
| IUPAC Name | 13-isocyano-6-[2,4,6-tri(propan-2-yl)phenyl]-10-azaheptacyclo[13.6.6.02,14.03,11.04,9.016,21.022,27]heptacosa-2,4(9),5,7,11,13,16,18,20,22,24,26-dodecaene |
| SMILES | [C-]#[N+]c1cc2[nH]c3ccc(-c4c(C(C)C)cc(C(C)C)cc4C(C)C)cc3c2c2c1C1c3ccccc3C2c2ccccc21 |
| InChI | InChI=1S/C42H38N2/c1-22(2)26-19-31(23(3)4)37(32(20-26)24(5)6)25-16-17-34-33(18-25)40-36(44-34)21-35(43-7)41-38-27-12-8-10-14-29(27)39(42(40)41)30-15-11-9-13-28(30)38/h8-24,38-39,44H,1-6H3 |
| InChIKey | OBBSKNNUQKQWSU-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 20.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.78 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|