C31H23ClN2 — CID 176762953
6-tert-butyl-8-chloro-13-isocyano-10-azaheptacyclo[13.6.6.02,14.03,11.04,9.016,21.022,27]heptacosa-2,4(9),5,7,11,13,16,18,20,22,24,26-dodecaene (PubChem CID 176762953) has the molecular formula C31H23ClN2 and a molecular weight of 458.99 g/mol. Its IUPAC name is 6-tert-butyl-8-chloro-13-isocyano-10-azaheptacyclo[13.6.6.02,14.03,11.04,9.016,21.022,27]heptacosa-2,4(9),5,7,11,13,16,18,20,22,24,26-dodecaene.
| Compound Name | 6-tert-butyl-8-chloro-13-isocyano-10-azaheptacyclo[13.6.6.02,14.03,11.04,9.016,21.022,27]heptacosa-2,4(9),5,7,11,13,16,18,20,22,24,26-dodecaene |
|---|---|
| PubChem CID | 176762953 |
| Molecular Formula | C31H23ClN2 |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 6-tert-butyl-8-chloro-13-isocyano-10-azaheptacyclo[13.6.6.02,14.03,11.04,9.016,21.022,27]heptacosa-2,4(9),5,7,11,13,16,18,20,22,24,26-dodecaene |
| SMILES | [C-]#[N+]c1cc2[nH]c3c(Cl)cc(C(C)(C)C)cc3c2c2c1C1c3ccccc3C2c2ccccc21 |
| InChI | InChI=1S/C31H23ClN2/c1-31(2,3)16-13-21-27-24(34-30(21)22(32)14-16)15-23(33-4)28-25-17-9-5-7-11-19(17)26(29(27)28)20-12-8-6-10-18(20)25/h5-15,25-26,34H,1-3H3 |
| InChIKey | VQOOVXAZVLDVAY-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 20.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|