C25H28ClNO — CID 176762943
7-tert-butyl-9-chloro-1,16-dimethyl-11-azapentacyclo[14.2.2.02,14.04,12.05,10]icosa-2(14),3,5(10),6,8,12-hexaen-15-one (PubChem CID 176762943) has the molecular formula C25H28ClNO and a molecular weight of 393.96 g/mol. Its IUPAC name is 7-tert-butyl-9-chloro-1,16-dimethyl-11-azapentacyclo[14.2.2.02,14.04,12.05,10]icosa-2(14),3,5(10),6,8,12-hexaen-15-one.
| Compound Name | 7-tert-butyl-9-chloro-1,16-dimethyl-11-azapentacyclo[14.2.2.02,14.04,12.05,10]icosa-2(14),3,5(10),6,8,12-hexaen-15-one |
|---|---|
| PubChem CID | 176762943 |
| Molecular Formula | C25H28ClNO |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 7-tert-butyl-9-chloro-1,16-dimethyl-11-azapentacyclo[14.2.2.02,14.04,12.05,10]icosa-2(14),3,5(10),6,8,12-hexaen-15-one |
| SMILES | CC12CCC(C)(CC1)c1cc3c(cc1C2=O)[nH]c1c(Cl)cc(C(C)(C)C)cc13 |
| InChI | InChI=1S/C25H28ClNO/c1-23(2,3)14-10-16-15-12-18-17(13-20(15)27-21(16)19(26)11-14)22(28)25(5)8-6-24(18,4)7-9-25/h10-13,27H,6-9H2,1-5H3 |
| InChIKey | NAFYKNPKHNJPJH-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |