C47H48N2 — CID 176762945
12-(2,2-dimethylpropyl)-13-isocyano-6-[2,4,6-tri(propan-2-yl)phenyl]-10-azaheptacyclo[13.6.6.02,14.03,11.04,9.016,21.022,27]heptacosa-2,4(9),5,7,11,13,16,18,20,22,24,26-dodecaene (PubChem CID 176762945) has the molecular formula C47H48N2 and a molecular weight of 640.91 g/mol. Its IUPAC name is 12-(2,2-dimethylpropyl)-13-isocyano-6-[2,4,6-tri(propan-2-yl)phenyl]-10-azaheptacyclo[13.6.6.02,14.03,11.04,9.016,21.022,27]heptacosa-2,4(9),5,7,11,13,16,18,20,22,24,26-dodecaene.
| Compound Name | 12-(2,2-dimethylpropyl)-13-isocyano-6-[2,4,6-tri(propan-2-yl)phenyl]-10-azaheptacyclo[13.6.6.02,14.03,11.04,9.016,21.022,27]heptacosa-2,4(9),5,7,11,13,16,18,20,22,24,26-dodecaene |
|---|---|
| PubChem CID | 176762945 |
| Molecular Formula | C47H48N2 |
| Molecular Weight | 640.91 g/mol |
| Exact Mass | 640.38 |
| IUPAC Name | 12-(2,2-dimethylpropyl)-13-isocyano-6-[2,4,6-tri(propan-2-yl)phenyl]-10-azaheptacyclo[13.6.6.02,14.03,11.04,9.016,21.022,27]heptacosa-2,4(9),5,7,11,13,16,18,20,22,24,26-dodecaene |
| SMILES | [C-]#[N+]c1c2c(c3c([nH]c4ccc(-c5c(C(C)C)cc(C(C)C)cc5C(C)C)cc43)c1CC(C)(C)C)C1c3ccccc3C2c2ccccc21 |
| InChI | InChI=1S/C47H48N2/c1-25(2)29-22-34(26(3)4)39(35(23-29)27(5)6)28-19-20-38-36(21-28)42-43-40-30-15-11-13-17-32(30)41(33-18-14-12-16-31(33)40)44(43)45(48-10)37(46(42)49-38)24-47(7,8)9/h11-23,25-27,40-41,49H,24H2,1-9H3 |
| InChIKey | PNZDVIZTJMIQHI-UHFFFAOYSA-N |
| XLogP | 13.48 |
| TPSA | 20.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.91 |
| LogP ≤ 5 | 13.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|