C29H28N2O5 — CID 176771065
6,13-dibutyl-2-(3-methylphenoxy)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone (PubChem CID 176771065) has the molecular formula C29H28N2O5 and a molecular weight of 484.55 g/mol. Its IUPAC name is 6,13-dibutyl-2-(3-methylphenoxy)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone.
| Compound Name | 6,13-dibutyl-2-(3-methylphenoxy)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 176771065 |
| Molecular Formula | C29H28N2O5 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 6,13-dibutyl-2-(3-methylphenoxy)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaene-5,7,12,14-tetrone |
| SMILES | CCCCN1C(=O)c2ccc3c4c(c(Oc5cccc(C)c5)cc(c24)C1=O)C(=O)N(CCCC)C3=O |
| InChI | InChI=1S/C29H28N2O5/c1-4-6-13-30-26(32)19-11-12-20-24-23(19)21(28(30)34)16-22(36-18-10-8-9-17(3)15-18)25(24)29(35)31(27(20)33)14-7-5-2/h8-12,15-16H,4-7,13-14H2,1-3H3 |
| InChIKey | RCFWQRLQFUJLMP-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|