C37H22N4O5 — CID 176771068
2-[13-(2-isocyano-4-methylphenyl)-3-(3-methylphenoxy)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaen-6-yl]-5-methylbenzonitrile (PubChem CID 176771068) has the molecular formula C37H22N4O5 and a molecular weight of 602.61 g/mol. Its IUPAC name is 2-[13-(2-isocyano-4-methylphenyl)-3-(3-methylphenoxy)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaen-6-yl]-5-methylbenzonitrile.
| Compound Name | 2-[13-(2-isocyano-4-methylphenyl)-3-(3-methylphenoxy)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaen-6-yl]-5-methylbenzonitrile |
|---|---|
| PubChem CID | 176771068 |
| Molecular Formula | C37H22N4O5 |
| Molecular Weight | 602.61 g/mol |
| Exact Mass | 602.16 |
| IUPAC Name | 2-[13-(2-isocyano-4-methylphenyl)-3-(3-methylphenoxy)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8(16),9,11(15)-pentaen-6-yl]-5-methylbenzonitrile |
| SMILES | [C-]#[N+]c1cc(C)ccc1N1C(=O)c2ccc3c4c(c(Oc5cccc(C)c5)cc(c24)C1=O)C(=O)N(c1ccc(C)cc1C#N)C3=O |
| InChI | InChI=1S/C37H22N4O5/c1-19-6-5-7-23(15-19)46-30-17-26-31-24(34(42)41(36(26)44)29-13-9-21(3)16-27(29)39-4)10-11-25-32(31)33(30)37(45)40(35(25)43)28-12-8-20(2)14-22(28)18-38/h5-17H,1-3H3 |
| InChIKey | AAPGHNASEVPTDH-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 112.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.61 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|