C44H22N8O4 — CID 171043335
2-[5-(4-amino-2-cyanophenyl)-1,3-dioxoisoindol-2-yl]-5-[4-[5-(4-amino-2-cyanophenyl)-1,3-dioxoisoindol-2-yl]-3-isocyanophenyl]benzonitrile (PubChem CID 171043335) has the molecular formula C44H22N8O4 and a molecular weight of 726.71 g/mol. Its IUPAC name is 2-[5-(4-amino-2-cyanophenyl)-1,3-dioxoisoindol-2-yl]-5-[4-[5-(4-amino-2-cyanophenyl)-1,3-dioxoisoindol-2-yl]-3-isocyanophenyl]benzonitrile.
| Compound Name | 2-[5-(4-amino-2-cyanophenyl)-1,3-dioxoisoindol-2-yl]-5-[4-[5-(4-amino-2-cyanophenyl)-1,3-dioxoisoindol-2-yl]-3-isocyanophenyl]benzonitrile |
|---|---|
| PubChem CID | 171043335 |
| Molecular Formula | C44H22N8O4 |
| Molecular Weight | 726.71 g/mol |
| Exact Mass | 726.18 |
| IUPAC Name | 2-[5-(4-amino-2-cyanophenyl)-1,3-dioxoisoindol-2-yl]-5-[4-[5-(4-amino-2-cyanophenyl)-1,3-dioxoisoindol-2-yl]-3-isocyanophenyl]benzonitrile |
| SMILES | [C-]#[N+]c1cc(-c2ccc(N3C(=O)c4ccc(-c5ccc(N)cc5C#N)cc4C3=O)c(C#N)c2)ccc1N1C(=O)c2ccc(-c3ccc(N)cc3C#N)cc2C1=O |
| InChI | InChI=1S/C44H22N8O4/c1-50-38-19-24(5-13-40(38)52-42(54)35-9-3-26(18-37(35)44(52)56)33-11-7-31(49)16-28(33)21-46)23-4-12-39(29(14-23)22-47)51-41(53)34-8-2-25(17-36(34)43(51)55)32-10-6-30(48)15-27(32)20-45/h2-19H,48-49H2 |
| InChIKey | MBHSYEZGFATXLT-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 202.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.71 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|