C21H14N6O4 — CID 166021733
5-amino-2-[(5S)-2-(4-amino-2-isocyanophenyl)-1,3,6,8-tetraoxo-2,7-diazaspiro[4.4]nonan-7-yl]benzonitrile (PubChem CID 166021733) has the molecular formula C21H14N6O4 and a molecular weight of 414.38 g/mol. Its IUPAC name is 5-amino-2-[(5S)-2-(4-amino-2-isocyanophenyl)-1,3,6,8-tetraoxo-2,7-diazaspiro[4.4]nonan-7-yl]benzonitrile.
| Compound Name | 5-amino-2-[(5S)-2-(4-amino-2-isocyanophenyl)-1,3,6,8-tetraoxo-2,7-diazaspiro[4.4]nonan-7-yl]benzonitrile |
|---|---|
| PubChem CID | 166021733 |
| Molecular Formula | C21H14N6O4 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 5-amino-2-[(5S)-2-(4-amino-2-isocyanophenyl)-1,3,6,8-tetraoxo-2,7-diazaspiro[4.4]nonan-7-yl]benzonitrile |
| SMILES | [C-]#[N+]c1cc(N)ccc1N1C(=O)C[C@]2(CC(=O)N(c3ccc(N)cc3C#N)C2=O)C1=O |
| InChI | InChI=1S/C21H14N6O4/c1-25-14-7-13(24)3-5-16(14)27-18(29)9-21(20(27)31)8-17(28)26(19(21)30)15-4-2-12(23)6-11(15)10-22/h2-7H,8-9,23-24H2/t21-/m0/s1 |
| InChIKey | SSGNZMLELXDEJU-NRFANRHFSA-N |
| XLogP | 1.49 |
| TPSA | 154.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|