C45H24N8O7S — CID 171043312
5-amino-2-[2-[4-[4-[5-(4-amino-2-cyano-6-isocyanophenyl)-1,3-dioxoisoindol-2-yl]-3-methoxyphenyl]sulfonylphenyl]-1,3-dioxoisoindol-5-yl]benzene-1,3-dicarbonitrile (PubChem CID 171043312) has the molecular formula C45H24N8O7S and a molecular weight of 820.80 g/mol. Its IUPAC name is 5-amino-2-[2-[4-[4-[5-(4-amino-2-cyano-6-isocyanophenyl)-1,3-dioxoisoindol-2-yl]-3-methoxyphenyl]sulfonylphenyl]-1,3-dioxoisoindol-5-yl]benzene-1,3-dicarbonitrile.
| Compound Name | 5-amino-2-[2-[4-[4-[5-(4-amino-2-cyano-6-isocyanophenyl)-1,3-dioxoisoindol-2-yl]-3-methoxyphenyl]sulfonylphenyl]-1,3-dioxoisoindol-5-yl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 171043312 |
| Molecular Formula | C45H24N8O7S |
| Molecular Weight | 820.80 g/mol |
| Exact Mass | 820.15 |
| IUPAC Name | 5-amino-2-[2-[4-[4-[5-(4-amino-2-cyano-6-isocyanophenyl)-1,3-dioxoisoindol-2-yl]-3-methoxyphenyl]sulfonylphenyl]-1,3-dioxoisoindol-5-yl]benzene-1,3-dicarbonitrile |
| SMILES | [C-]#[N+]c1cc(N)cc(C#N)c1-c1ccc2c(c1)C(=O)N(c1ccc(S(=O)(=O)c3ccc(N4C(=O)c5ccc(-c6c(C#N)cc(N)cc6C#N)cc5C4=O)cc3)cc1OC)C2=O |
| InChI | InChI=1S/C45H24N8O7S/c1-51-37-18-29(50)15-27(22-48)41(37)24-4-11-34-36(17-24)45(57)53(43(34)55)38-12-9-32(19-39(38)60-2)61(58,59)31-7-5-30(6-8-31)52-42(54)33-10-3-23(16-35(33)44(52)56)40-25(20-46)13-28(49)14-26(40)21-47/h3-19H,49-50H2,2H3 |
| InChIKey | INEBXPKMFSSJNH-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 245.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.80 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|