C33H25N3O4 — CID 176771784
4-[[[4-phenoxy-1-(quinolin-7-ylmethyl)indole-7-carbonyl]amino]methyl]benzoic acid (PubChem CID 176771784) has the molecular formula C33H25N3O4 and a molecular weight of 527.58 g/mol. Its IUPAC name is 4-[[[4-phenoxy-1-(quinolin-7-ylmethyl)indole-7-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[4-phenoxy-1-(quinolin-7-ylmethyl)indole-7-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 176771784 |
| Molecular Formula | C33H25N3O4 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | 4-[[[4-phenoxy-1-(quinolin-7-ylmethyl)indole-7-carbonyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)c2ccc(Oc3ccccc3)c3ccn(Cc4ccc5cccnc5c4)c23)cc1 |
| InChI | InChI=1S/C33H25N3O4/c37-32(35-20-22-8-12-25(13-9-22)33(38)39)28-14-15-30(40-26-6-2-1-3-7-26)27-16-18-36(31(27)28)21-23-10-11-24-5-4-17-34-29(24)19-23/h1-19H,20-21H2,(H,35,37)(H,38,39) |
| InChIKey | ZJZDFPBSFZDBTE-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |