C31H35O3S+ — CID 176774421
[4-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]cyclohexa-1,3-dien-1-yl]-diphenylsulfanium (PubChem CID 176774421) has the molecular formula C31H35O3S+ and a molecular weight of 487.69 g/mol. Its IUPAC name is [4-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]cyclohexa-1,3-dien-1-yl]-diphenylsulfanium.
| Compound Name | [4-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]cyclohexa-1,3-dien-1-yl]-diphenylsulfanium |
|---|---|
| PubChem CID | 176774421 |
| Molecular Formula | C31H35O3S+ |
| Molecular Weight | 487.69 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | [4-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]cyclohexa-1,3-dien-1-yl]-diphenylsulfanium |
| SMILES | CC1(OC(=O)COC2=CC=C([S+](c3ccccc3)c3ccccc3)CC2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C31H35O3S/c1-31(24-17-22-16-23(19-24)20-25(31)18-22)34-30(32)21-33-26-12-14-29(15-13-26)35(27-8-4-2-5-9-27)28-10-6-3-7-11-28/h2-12,14,22-25H,13,15-21H2,1H3/q+1 |
| InChIKey | ZRVBYOABJPTGHQ-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.69 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|