C32H37O3S+ — CID 140652537
[(3Z)-3-methyl-5-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]hexa-1,3,5-trien-2-yl]-diphenylsulfanium (PubChem CID 140652537) has the molecular formula C32H37O3S+ and a molecular weight of 501.71 g/mol. Its IUPAC name is [(3Z)-3-methyl-5-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]hexa-1,3,5-trien-2-yl]-diphenylsulfanium.
| Compound Name | [(3Z)-3-methyl-5-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]hexa-1,3,5-trien-2-yl]-diphenylsulfanium |
|---|---|
| PubChem CID | 140652537 |
| Molecular Formula | C32H37O3S+ |
| Molecular Weight | 501.71 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | [(3Z)-3-methyl-5-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]hexa-1,3,5-trien-2-yl]-diphenylsulfanium |
| SMILES | C=C(/C=C(/C)C(=C)[S+](c1ccccc1)c1ccccc1)OCC(=O)OC1(C)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C32H37O3S/c1-22(24(3)36(29-11-7-5-8-12-29)30-13-9-6-10-14-30)15-23(2)34-21-31(33)35-32(4)27-17-25-16-26(19-27)20-28(32)18-25/h5-15,25-28H,2-3,16-21H2,1,4H3/q+1/b22-15- |
| InChIKey | BVISQWGLBFNVGL-JCMHNJIXSA-N |
| XLogP | 7.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.71 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|