C35H43O5S+ — CID 140663483
[(3E)-hexa-1,3,5-trien-3-yl]-[(3Z,5Z)-4-methyl-5-[2-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]-2-oxoethoxy]hepta-1,3,5-trien-2-yl]-phenylsulfanium (PubChem CID 140663483) has the molecular formula C35H43O5S+ and a molecular weight of 575.79 g/mol. Its IUPAC name is [(3E)-hexa-1,3,5-trien-3-yl]-[(3Z,5Z)-4-methyl-5-[2-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]-2-oxoethoxy]hepta-1,3,5-trien-2-yl]-phenylsulfanium.
| Compound Name | [(3E)-hexa-1,3,5-trien-3-yl]-[(3Z,5Z)-4-methyl-5-[2-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]-2-oxoethoxy]hepta-1,3,5-trien-2-yl]-phenylsulfanium |
|---|---|
| PubChem CID | 140663483 |
| Molecular Formula | C35H43O5S+ |
| Molecular Weight | 575.79 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | [(3E)-hexa-1,3,5-trien-3-yl]-[(3Z,5Z)-4-methyl-5-[2-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]-2-oxoethoxy]hepta-1,3,5-trien-2-yl]-phenylsulfanium |
| SMILES | C=C/C=C(\C=C)[S+](C(=C)/C=C(C)\C(=C\C)OCC(=O)OCC(=O)OC1(C)C2CC3CC(C2)CC1C3)c1ccccc1 |
| InChI | InChI=1S/C35H43O5S/c1-7-13-30(8-2)41(31-14-11-10-12-15-31)25(5)16-24(4)32(9-3)38-22-33(36)39-23-34(37)40-35(6)28-18-26-17-27(20-28)21-29(35)19-26/h7-16,26-29H,1-2,5,17-23H2,3-4,6H3/q+1/b24-16-,30-13+,32-9- |
| InChIKey | JRLBJZNWWVGADH-IENSBCSCSA-N |
| XLogP | 7.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.79 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|