C34H37O5S+ — CID 163845124
[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethyl] 2-(5-dibenzothiophen-5-ium-5-yl-2-methoxycyclohexa-1,5-dien-1-yl)acetate (PubChem CID 163845124) has the molecular formula C34H37O5S+ and a molecular weight of 557.73 g/mol. Its IUPAC name is [2-[(2-methyl-2-adamantyl)oxy]-2-oxoethyl] 2-(5-dibenzothiophen-5-ium-5-yl-2-methoxycyclohexa-1,5-dien-1-yl)acetate.
| Compound Name | [2-[(2-methyl-2-adamantyl)oxy]-2-oxoethyl] 2-(5-dibenzothiophen-5-ium-5-yl-2-methoxycyclohexa-1,5-dien-1-yl)acetate |
|---|---|
| PubChem CID | 163845124 |
| Molecular Formula | C34H37O5S+ |
| Molecular Weight | 557.73 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | [2-[(2-methyl-2-adamantyl)oxy]-2-oxoethyl] 2-(5-dibenzothiophen-5-ium-5-yl-2-methoxycyclohexa-1,5-dien-1-yl)acetate |
| SMILES | COC1=C(CC(=O)OCC(=O)OC2(C)C3CC4CC(C3)CC2C4)C=C([s+]2c3ccccc3c3ccccc32)CC1 |
| InChI | InChI=1S/C34H37O5S/c1-34(24-14-21-13-22(16-24)17-25(34)15-21)39-33(36)20-38-32(35)19-23-18-26(11-12-29(23)37-2)40-30-9-5-3-7-27(30)28-8-4-6-10-31(28)40/h3-10,18,21-22,24-25H,11-17,19-20H2,1-2H3/q+1 |
| InChIKey | OPMJKIHDFJXQQM-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.73 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|