C33H37O3S+ — CID 164834645
(2-methyl-2-adamantyl) 2-(4-dibenzothiophen-5-ium-5-yl-2,6-dimethylcyclohexa-1,3-dien-1-yl)oxyacetate (PubChem CID 164834645) has the molecular formula C33H37O3S+ and a molecular weight of 513.72 g/mol. Its IUPAC name is (2-methyl-2-adamantyl) 2-(4-dibenzothiophen-5-ium-5-yl-2,6-dimethylcyclohexa-1,3-dien-1-yl)oxyacetate.
| Compound Name | (2-methyl-2-adamantyl) 2-(4-dibenzothiophen-5-ium-5-yl-2,6-dimethylcyclohexa-1,3-dien-1-yl)oxyacetate |
|---|---|
| PubChem CID | 164834645 |
| Molecular Formula | C33H37O3S+ |
| Molecular Weight | 513.72 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | (2-methyl-2-adamantyl) 2-(4-dibenzothiophen-5-ium-5-yl-2,6-dimethylcyclohexa-1,3-dien-1-yl)oxyacetate |
| SMILES | CC1=C(OCC(=O)OC2(C)C3CC4CC(C3)CC2C4)C(C)CC([s+]2c3ccccc3c3ccccc32)=C1 |
| InChI | InChI=1S/C33H37O3S/c1-20-12-26(37-29-10-6-4-8-27(29)28-9-5-7-11-30(28)37)13-21(2)32(20)35-19-31(34)36-33(3)24-15-22-14-23(17-24)18-25(33)16-22/h4-12,21-25H,13-19H2,1-3H3/q+1 |
| InChIKey | YWNKCXYAUZWRRN-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.72 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|