C15H21NO3S — CID 176776937
ethyl 2-(2-carbamoyl-4-ethyl-3,5-dimethylphenyl)sulfanylacetate (PubChem CID 176776937) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is ethyl 2-(2-carbamoyl-4-ethyl-3,5-dimethylphenyl)sulfanylacetate.
| Compound Name | ethyl 2-(2-carbamoyl-4-ethyl-3,5-dimethylphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 176776937 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | ethyl 2-(2-carbamoyl-4-ethyl-3,5-dimethylphenyl)sulfanylacetate |
| SMILES | CCOC(=O)CSc1cc(C)c(CC)c(C)c1C(N)=O |
| InChI | InChI=1S/C15H21NO3S/c1-5-11-9(3)7-12(14(10(11)4)15(16)18)20-8-13(17)19-6-2/h7H,5-6,8H2,1-4H3,(H2,16,18) |
| InChIKey | KFJCAXGIGKPGSQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |