C14H25NO — CID 176777066
N-(7,7-dimethyloct-5-ynyl)-2-methylpropanamide (PubChem CID 176777066) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is N-(7,7-dimethyloct-5-ynyl)-2-methylpropanamide.
| Compound Name | N-(7,7-dimethyloct-5-ynyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 176777066 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | N-(7,7-dimethyloct-5-ynyl)-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCCCCC#CC(C)(C)C |
| InChI | InChI=1S/C14H25NO/c1-12(2)13(16)15-11-9-7-6-8-10-14(3,4)5/h12H,6-7,9,11H2,1-5H3,(H,15,16) |
| InChIKey | UOJQQCQQMNZWBJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|