C10H24Cl2N4O2 — CID 10494630
[(2S)-1-[4-[[(2S)-2-azaniumylpropanoyl]amino]butylamino]-1-oxopropan-2-yl]azanium dichloride (PubChem CID 10494630) has the molecular formula C10H24Cl2N4O2 and a molecular weight of 303.23 g/mol. Its IUPAC name is [(2S)-1-[4-[[(2S)-2-azaniumylpropanoyl]amino]butylamino]-1-oxopropan-2-yl]azanium dichloride.
| Compound Name | [(2S)-1-[4-[[(2S)-2-azaniumylpropanoyl]amino]butylamino]-1-oxopropan-2-yl]azanium dichloride |
|---|---|
| PubChem CID | 10494630 |
| Molecular Formula | C10H24Cl2N4O2 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [(2S)-1-[4-[[(2S)-2-azaniumylpropanoyl]amino]butylamino]-1-oxopropan-2-yl]azanium dichloride |
| SMILES | C[C@H]([NH3+])C(=O)NCCCCNC(=O)[C@H](C)[NH3+].[Cl-].[Cl-] |
| InChI | InChI=1S/C10H22N4O2.2ClH/c1-7(11)9(15)13-5-3-4-6-14-10(16)8(2)12;;/h7-8H,3-6,11-12H2,1-2H3,(H,13,15)(H,14,16);2*1H/t7-,8-;;/m0../s1 |
| InChIKey | QETNDVHLGZLUIN-FOMWZSOGSA-N |
| XLogP | -8.73 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | -8.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|