C36H42N3+ — CID 176779959
(2E)-2-[(2Z,4E)-5-(3,3-dimethyl-1-propylindol-1-ium-2-yl)-3-pyridin-4-ylpenta-2,4-dienylidene]-3,3-dimethyl-1-propylindole (PubChem CID 176779959) has the molecular formula C36H42N3+ and a molecular weight of 516.75 g/mol. Its IUPAC name is (2E)-2-[(2Z,4E)-5-(3,3-dimethyl-1-propylindol-1-ium-2-yl)-3-pyridin-4-ylpenta-2,4-dienylidene]-3,3-dimethyl-1-propylindole.
| Compound Name | (2E)-2-[(2Z,4E)-5-(3,3-dimethyl-1-propylindol-1-ium-2-yl)-3-pyridin-4-ylpenta-2,4-dienylidene]-3,3-dimethyl-1-propylindole |
|---|---|
| PubChem CID | 176779959 |
| Molecular Formula | C36H42N3+ |
| Molecular Weight | 516.75 g/mol |
| Exact Mass | 516.34 |
| IUPAC Name | (2E)-2-[(2Z,4E)-5-(3,3-dimethyl-1-propylindol-1-ium-2-yl)-3-pyridin-4-ylpenta-2,4-dienylidene]-3,3-dimethyl-1-propylindole |
| SMILES | CCCN1/C(=C/C=C(/C=C/C2=[N+](CCC)c3ccccc3C2(C)C)c2ccncc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C36H42N3/c1-7-25-38-31-15-11-9-13-29(31)35(3,4)33(38)19-17-27(28-21-23-37-24-22-28)18-20-34-36(5,6)30-14-10-12-16-32(30)39(34)26-8-2/h9-24H,7-8,25-26H2,1-6H3/q+1 |
| InChIKey | ITHNNRAWYOTKQR-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 19.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.75 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|