C24H43F6NO3 — CID 176800294
1,1,1,15,15,15-hexafluoropentadecan-7-yl 7-(2-hydroxyethylamino)heptanoate (PubChem CID 176800294) has the molecular formula C24H43F6NO3 and a molecular weight of 507.60 g/mol. Its IUPAC name is 1,1,1,15,15,15-hexafluoropentadecan-7-yl 7-(2-hydroxyethylamino)heptanoate.
| Compound Name | 1,1,1,15,15,15-hexafluoropentadecan-7-yl 7-(2-hydroxyethylamino)heptanoate |
|---|---|
| PubChem CID | 176800294 |
| Molecular Formula | C24H43F6NO3 |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.31 |
| IUPAC Name | 1,1,1,15,15,15-hexafluoropentadecan-7-yl 7-(2-hydroxyethylamino)heptanoate |
| SMILES | O=C(CCCCCCNCCO)OC(CCCCCCCC(F)(F)F)CCCCCC(F)(F)F |
| InChI | InChI=1S/C24H43F6NO3/c25-23(26,27)16-10-4-1-2-7-13-21(14-8-6-11-17-24(28,29)30)34-22(33)15-9-3-5-12-18-31-19-20-32/h21,31-32H,1-20H2 |
| InChIKey | BZLPROSOBHFVCN-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|