C46H79F12NO5 — CID 169189855
1,1,1,15,15,15-hexafluoropentadecan-7-yl 7-[[7-(1,1,1,15,15,15-hexafluoropentadecan-7-yloxy)-7-oxoheptyl]-(2-hydroxyethyl)amino]heptanoate (PubChem CID 169189855) has the molecular formula C46H79F12NO5 and a molecular weight of 954.12 g/mol. Its IUPAC name is 1,1,1,15,15,15-hexafluoropentadecan-7-yl 7-[[7-(1,1,1,15,15,15-hexafluoropentadecan-7-yloxy)-7-oxoheptyl]-(2-hydroxyethyl)amino]heptanoate.
| Compound Name | 1,1,1,15,15,15-hexafluoropentadecan-7-yl 7-[[7-(1,1,1,15,15,15-hexafluoropentadecan-7-yloxy)-7-oxoheptyl]-(2-hydroxyethyl)amino]heptanoate |
|---|---|
| PubChem CID | 169189855 |
| Molecular Formula | C46H79F12NO5 |
| Molecular Weight | 954.12 g/mol |
| Exact Mass | 953.58 |
| IUPAC Name | 1,1,1,15,15,15-hexafluoropentadecan-7-yl 7-[[7-(1,1,1,15,15,15-hexafluoropentadecan-7-yloxy)-7-oxoheptyl]-(2-hydroxyethyl)amino]heptanoate |
| SMILES | O=C(CCCCCCN(CCO)CCCCCCC(=O)OC(CCCCCCCC(F)(F)F)CCCCCC(F)(F)F)OC(CCCCCCCC(F)(F)F)CCCCCC(F)(F)F |
| InChI | InChI=1S/C46H79F12NO5/c47-43(48,49)31-19-7-1-3-13-25-39(27-15-11-21-33-45(53,54)55)63-41(61)29-17-5-9-23-35-59(37-38-60)36-24-10-6-18-30-42(62)64-40(28-16-12-22-34-46(56,57)58)26-14-4-2-8-20-32-44(50,51)52/h39-40,60H,1-38H2 |
| InChIKey | JVLCASXKILETDR-UHFFFAOYSA-N |
| XLogP | 15.62 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 954.12 |
| LogP ≤ 5 | 15.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|