C49H97NO5 — CID 146564448
octadecan-9-yl 8-[2-hydroxyethyl-[8-(4-methyldodecan-4-yloxy)-8-oxooctyl]amino]octanoate (PubChem CID 146564448) has the molecular formula C49H97NO5 and a molecular weight of 780.32 g/mol. Its IUPAC name is octadecan-9-yl 8-[2-hydroxyethyl-[8-(4-methyldodecan-4-yloxy)-8-oxooctyl]amino]octanoate.
| Compound Name | octadecan-9-yl 8-[2-hydroxyethyl-[8-(4-methyldodecan-4-yloxy)-8-oxooctyl]amino]octanoate |
|---|---|
| PubChem CID | 146564448 |
| Molecular Formula | C49H97NO5 |
| Molecular Weight | 780.32 g/mol |
| Exact Mass | 779.74 |
| IUPAC Name | octadecan-9-yl 8-[2-hydroxyethyl-[8-(4-methyldodecan-4-yloxy)-8-oxooctyl]amino]octanoate |
| SMILES | CCCCCCCCCC(CCCCCCCC)OC(=O)CCCCCCCN(CCO)CCCCCCCC(=O)OC(C)(CCC)CCCCCCCC |
| InChI | InChI=1S/C49H97NO5/c1-6-10-13-16-19-23-30-37-46(36-29-22-17-14-11-7-2)54-47(52)38-31-24-20-27-34-42-50(44-45-51)43-35-28-21-25-32-39-48(53)55-49(5,40-9-4)41-33-26-18-15-12-8-3/h46,51H,6-45H2,1-5H3 |
| InChIKey | HVHTWPSYKKBOAU-UHFFFAOYSA-N |
| XLogP | 14.62 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.32 |
| LogP ≤ 5 | 14.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|