C51H103NO4 — CID 153453910
15-ethylicosan-9-yl 8-[2-hydroxyethyl-(9-hydroxy-9-methyloctadecyl)amino]octanoate (PubChem CID 153453910) has the molecular formula C51H103NO4 and a molecular weight of 794.39 g/mol. Its IUPAC name is 15-ethylicosan-9-yl 8-[2-hydroxyethyl-(9-hydroxy-9-methyloctadecyl)amino]octanoate.
| Compound Name | 15-ethylicosan-9-yl 8-[2-hydroxyethyl-(9-hydroxy-9-methyloctadecyl)amino]octanoate |
|---|---|
| PubChem CID | 153453910 |
| Molecular Formula | C51H103NO4 |
| Molecular Weight | 794.39 g/mol |
| Exact Mass | 793.79 |
| IUPAC Name | 15-ethylicosan-9-yl 8-[2-hydroxyethyl-(9-hydroxy-9-methyloctadecyl)amino]octanoate |
| SMILES | CCCCCCCCCC(C)(O)CCCCCCCCN(CCO)CCCCCCCC(=O)OC(CCCCCCCC)CCCCCC(CC)CCCCC |
| InChI | InChI=1S/C51H103NO4/c1-6-10-13-15-17-23-33-42-51(5,55)43-34-24-18-19-25-35-44-52(46-47-53)45-36-26-20-22-32-41-50(54)56-49(39-30-21-16-14-11-7-2)40-31-27-29-38-48(9-4)37-28-12-8-3/h48-49,53,55H,6-47H2,1-5H3 |
| InChIKey | WFAUVQJTKVIJGJ-UHFFFAOYSA-N |
| XLogP | 15.46 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.39 |
| LogP ≤ 5 | 15.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|