About 6-tert-butyl-3,3-difluoro-1-azatricyclo[4.3.0.02,4]nonane
6-tert-butyl-3,3-difluoro-1-azatricyclo[4.3.0.02,4]nonane (PubChem CID 176800835) has the molecular formula C12H19F2N
and a molecular weight of 215.29 g/mol. Its IUPAC name is 6-tert-butyl-3,3-difluoro-1-azatricyclo[4.3.0.02,4]nonane.
Molecular Properties
| Compound Name | 6-tert-butyl-3,3-difluoro-1-azatricyclo[4.3.0.02,4]nonane |
| PubChem CID | 176800835 |
| Molecular Formula | C12H19F2N |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 6-tert-butyl-3,3-difluoro-1-azatricyclo[4.3.0.02,4]nonane |
| SMILES | CC(C)(C)C12CCCN1C1C(C2)C1(F)F |
| InChI | InChI=1S/C12H19F2N/c1-10(2,3)11-5-4-6-15(11)9-8(7-11)12(9,13)14/h8-9H,4-7H2,1-3H3 |
| InChIKey | GWJPPSJDRJAHQD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-tert-butyl-3,3-difluoro-1-azatricyclo[4.3.0.02,4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-3,3-difluoro-1-azatricyclo[4.3.0.02,4]nonane?
The IUPAC name of 6-tert-butyl-3,3-difluoro-1-azatricyclo[4.3.0.02,4]nonane (CID 176800835) is 6-tert-butyl-3,3-difluoro-1-azatricyclo[4.3.0.02,4]nonane.
What is the SMILES notation for 6-tert-butyl-3,3-difluoro-1-azatricyclo[4.3.0.02,4]nonane?
The canonical SMILES for 6-tert-butyl-3,3-difluoro-1-azatricyclo[4.3.0.02,4]nonane is CC(C)(C)C12CCCN1C1C(C2)C1(F)F.
What is the InChIKey of 6-tert-butyl-3,3-difluoro-1-azatricyclo[4.3.0.02,4]nonane?
The InChIKey is GWJPPSJDRJAHQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F2N/c1-10(2,3)11-5-4-6-15(11)9-8(7-11)12(9,13)14/h8-9H,4-7H2,1-3H3.
What are the key properties of 6-tert-butyl-3,3-difluoro-1-azatricyclo[4.3.0.02,4]nonane?
6-tert-butyl-3,3-difluoro-1-azatricyclo[4.3.0.02,4]nonane has a molecular weight of 215.29 g/mol, XLogP of 2.90, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-3,3-difluoro-1-azatricyclo[4.3.0.02,4]nonane is sourced from PubChem (CID 176800835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).