About 2-[2-[2-[4-(oxan-2-yloxy)phenyl]acetyl]oxyethyldisulfanyl]ethyl 4-bromobutanoate
2-[2-[2-[4-(oxan-2-yloxy)phenyl]acetyl]oxyethyldisulfanyl]ethyl 4-bromobutanoate (PubChem CID 176801825) has the molecular formula C21H29BrO6S2
and a molecular weight of 521.50 g/mol. Its IUPAC name is 2-[2-[2-[4-(oxan-2-yloxy)phenyl]acetyl]oxyethyldisulfanyl]ethyl 4-bromobutanoate.
Molecular Properties
| Compound Name | 2-[2-[2-[4-(oxan-2-yloxy)phenyl]acetyl]oxyethyldisulfanyl]ethyl 4-bromobutanoate |
| PubChem CID | 176801825 |
| Molecular Formula | C21H29BrO6S2 |
| Molecular Weight | 521.50 g/mol |
| Exact Mass | 520.06 |
| IUPAC Name | 2-[2-[2-[4-(oxan-2-yloxy)phenyl]acetyl]oxyethyldisulfanyl]ethyl 4-bromobutanoate |
| SMILES | O=C(CCCBr)OCCSSCCOC(=O)Cc1ccc(OC2CCCCO2)cc1 |
| InChI | InChI=1S/C21H29BrO6S2/c22-10-3-4-19(23)25-12-14-29-30-15-13-26-20(24)16-17-6-8-18(9-7-17)28-21-5-1-2-11-27-21/h6-9,21H,1-5,10-16H2 |
| InChIKey | FDSIVWVUDKHEND-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 521.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[2-[4-(oxan-2-yloxy)phenyl]acetyl]oxyethyldisulfanyl]ethyl 4-bromobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-[4-(oxan-2-yloxy)phenyl]acetyl]oxyethyldisulfanyl]ethyl 4-bromobutanoate?
The IUPAC name of 2-[2-[2-[4-(oxan-2-yloxy)phenyl]acetyl]oxyethyldisulfanyl]ethyl 4-bromobutanoate (CID 176801825) is 2-[2-[2-[4-(oxan-2-yloxy)phenyl]acetyl]oxyethyldisulfanyl]ethyl 4-bromobutanoate.
What is the SMILES notation for 2-[2-[2-[4-(oxan-2-yloxy)phenyl]acetyl]oxyethyldisulfanyl]ethyl 4-bromobutanoate?
The canonical SMILES for 2-[2-[2-[4-(oxan-2-yloxy)phenyl]acetyl]oxyethyldisulfanyl]ethyl 4-bromobutanoate is O=C(CCCBr)OCCSSCCOC(=O)Cc1ccc(OC2CCCCO2)cc1.
What is the InChIKey of 2-[2-[2-[4-(oxan-2-yloxy)phenyl]acetyl]oxyethyldisulfanyl]ethyl 4-bromobutanoate?
The InChIKey is FDSIVWVUDKHEND-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29BrO6S2/c22-10-3-4-19(23)25-12-14-29-30-15-13-26-20(24)16-17-6-8-18(9-7-17)28-21-5-1-2-11-27-21/h6-9,21H,1-5,10-16H2.
What are the key properties of 2-[2-[2-[4-(oxan-2-yloxy)phenyl]acetyl]oxyethyldisulfanyl]ethyl 4-bromobutanoate?
2-[2-[2-[4-(oxan-2-yloxy)phenyl]acetyl]oxyethyldisulfanyl]ethyl 4-bromobutanoate has a molecular weight of 521.50 g/mol, XLogP of 4.78, 14 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-[4-(oxan-2-yloxy)phenyl]acetyl]oxyethyldisulfanyl]ethyl 4-bromobutanoate is sourced from PubChem (CID 176801825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).