C24H38N2O6S2 — CID 176801859
2-[2-[3-(dimethylamino)propyl-methylcarbamoyl]oxyethyldisulfanyl]ethyl 2-[4-(oxan-2-yloxy)phenyl]acetate (PubChem CID 176801859) has the molecular formula C24H38N2O6S2 and a molecular weight of 514.71 g/mol. Its IUPAC name is 2-[2-[3-(dimethylamino)propyl-methylcarbamoyl]oxyethyldisulfanyl]ethyl 2-[4-(oxan-2-yloxy)phenyl]acetate.
| Compound Name | 2-[2-[3-(dimethylamino)propyl-methylcarbamoyl]oxyethyldisulfanyl]ethyl 2-[4-(oxan-2-yloxy)phenyl]acetate |
|---|---|
| PubChem CID | 176801859 |
| Molecular Formula | C24H38N2O6S2 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | 2-[2-[3-(dimethylamino)propyl-methylcarbamoyl]oxyethyldisulfanyl]ethyl 2-[4-(oxan-2-yloxy)phenyl]acetate |
| SMILES | CN(C)CCCN(C)C(=O)OCCSSCCOC(=O)Cc1ccc(OC2CCCCO2)cc1 |
| InChI | InChI=1S/C24H38N2O6S2/c1-25(2)12-6-13-26(3)24(28)31-16-18-34-33-17-15-29-22(27)19-20-8-10-21(11-9-20)32-23-7-4-5-14-30-23/h8-11,23H,4-7,12-19H2,1-3H3 |
| InChIKey | OHGZHGSHIQCJSV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|