C27H43NO6S2 — CID 176801874
2-[2-[2-[4-(oxan-2-yloxy)phenyl]acetyl]oxyethyldisulfanyl]ethyl 4-(dipropylamino)butanoate (PubChem CID 176801874) has the molecular formula C27H43NO6S2 and a molecular weight of 541.78 g/mol. Its IUPAC name is 2-[2-[2-[4-(oxan-2-yloxy)phenyl]acetyl]oxyethyldisulfanyl]ethyl 4-(dipropylamino)butanoate.
| Compound Name | 2-[2-[2-[4-(oxan-2-yloxy)phenyl]acetyl]oxyethyldisulfanyl]ethyl 4-(dipropylamino)butanoate |
|---|---|
| PubChem CID | 176801874 |
| Molecular Formula | C27H43NO6S2 |
| Molecular Weight | 541.78 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | 2-[2-[2-[4-(oxan-2-yloxy)phenyl]acetyl]oxyethyldisulfanyl]ethyl 4-(dipropylamino)butanoate |
| SMILES | CCCN(CCC)CCCC(=O)OCCSSCCOC(=O)Cc1ccc(OC2CCCCO2)cc1 |
| InChI | InChI=1S/C27H43NO6S2/c1-3-14-28(15-4-2)16-7-8-25(29)31-18-20-35-36-21-19-32-26(30)22-23-10-12-24(13-11-23)34-27-9-5-6-17-33-27/h10-13,27H,3-9,14-22H2,1-2H3 |
| InChIKey | XVHWRQTZHCQVAY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.78 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|