C23H35NO6S2 — CID 176801850
2-[2-[2-[4-(oxan-2-yloxy)phenyl]acetyl]oxyethyldisulfanyl]ethyl 3-(dimethylamino)-2-methylpropanoate (PubChem CID 176801850) has the molecular formula C23H35NO6S2 and a molecular weight of 485.67 g/mol. Its IUPAC name is 2-[2-[2-[4-(oxan-2-yloxy)phenyl]acetyl]oxyethyldisulfanyl]ethyl 3-(dimethylamino)-2-methylpropanoate.
| Compound Name | 2-[2-[2-[4-(oxan-2-yloxy)phenyl]acetyl]oxyethyldisulfanyl]ethyl 3-(dimethylamino)-2-methylpropanoate |
|---|---|
| PubChem CID | 176801850 |
| Molecular Formula | C23H35NO6S2 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | 2-[2-[2-[4-(oxan-2-yloxy)phenyl]acetyl]oxyethyldisulfanyl]ethyl 3-(dimethylamino)-2-methylpropanoate |
| SMILES | CC(CN(C)C)C(=O)OCCSSCCOC(=O)Cc1ccc(OC2CCCCO2)cc1 |
| InChI | InChI=1S/C23H35NO6S2/c1-18(17-24(2)3)23(26)29-13-15-32-31-14-12-27-21(25)16-19-7-9-20(10-8-19)30-22-6-4-5-11-28-22/h7-10,18,22H,4-6,11-17H2,1-3H3 |
| InChIKey | DFTOCAUVIORFNA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|