C9H15NO2 — CID 176808735
[4-(hydroxymethyl)-1,2,3,4,5,6-hexahydrocyclopenta[c]pyrrol-6-yl]methanol (PubChem CID 176808735) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is [4-(hydroxymethyl)-1,2,3,4,5,6-hexahydrocyclopenta[c]pyrrol-6-yl]methanol.
| Compound Name | [4-(hydroxymethyl)-1,2,3,4,5,6-hexahydrocyclopenta[c]pyrrol-6-yl]methanol |
|---|---|
| PubChem CID | 176808735 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | [4-(hydroxymethyl)-1,2,3,4,5,6-hexahydrocyclopenta[c]pyrrol-6-yl]methanol |
| SMILES | OCC1CC(CO)C2=C1CNC2 |
| InChI | InChI=1S/C9H15NO2/c11-4-6-1-7(5-12)9-3-10-2-8(6)9/h6-7,10-12H,1-5H2 |
| InChIKey | AAPYSUGNNKXIHE-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|