C8H11NO2 — CID 176808764
[4-(hydroxymethyl)-7-azabicyclo[4.1.0]hepta-1(6),3-dien-3-yl]methanol (PubChem CID 176808764) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is [4-(hydroxymethyl)-7-azabicyclo[4.1.0]hepta-1(6),3-dien-3-yl]methanol.
| Compound Name | [4-(hydroxymethyl)-7-azabicyclo[4.1.0]hepta-1(6),3-dien-3-yl]methanol |
|---|---|
| PubChem CID | 176808764 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | [4-(hydroxymethyl)-7-azabicyclo[4.1.0]hepta-1(6),3-dien-3-yl]methanol |
| SMILES | OCC1=C(CO)CC2=C(C1)N2 |
| InChI | InChI=1S/C8H11NO2/c10-3-5-1-7-8(9-7)2-6(5)4-11/h9-11H,1-4H2 |
| InChIKey | UKSXLTKPUHHJMN-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|