C13H22O2 — CID 132558225
[(3aR,6S)-6-(hydroxymethyl)-4,4,6-trimethyl-2,3,3a,5-tetrahydropentalen-1-yl]methanol (PubChem CID 132558225) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is [(3aR,6S)-6-(hydroxymethyl)-4,4,6-trimethyl-2,3,3a,5-tetrahydropentalen-1-yl]methanol.
| Compound Name | [(3aR,6S)-6-(hydroxymethyl)-4,4,6-trimethyl-2,3,3a,5-tetrahydropentalen-1-yl]methanol |
|---|---|
| PubChem CID | 132558225 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | [(3aR,6S)-6-(hydroxymethyl)-4,4,6-trimethyl-2,3,3a,5-tetrahydropentalen-1-yl]methanol |
| SMILES | CC1(C)C[C@](C)(CO)C2=C(CO)CC[C@@H]21 |
| InChI | InChI=1S/C13H22O2/c1-12(2)7-13(3,8-15)11-9(6-14)4-5-10(11)12/h10,14-15H,4-8H2,1-3H3/t10-,13+/m0/s1 |
| InChIKey | QOJBCNDBPGPJNR-GXFFZTMASA-N |
| XLogP | 2.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|