C7H14O6 — CID 54199383
(1R,2S,3S,4R)-1,4-bis(hydroxymethyl)cyclopentane-1,2,3,4-tetrol (PubChem CID 54199383) has the molecular formula C7H14O6 and a molecular weight of 194.18 g/mol. Its IUPAC name is (1R,2S,3S,4R)-1,4-bis(hydroxymethyl)cyclopentane-1,2,3,4-tetrol.
| Compound Name | (1R,2S,3S,4R)-1,4-bis(hydroxymethyl)cyclopentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 54199383 |
| Molecular Formula | C7H14O6 |
| Molecular Weight | 194.18 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | (1R,2S,3S,4R)-1,4-bis(hydroxymethyl)cyclopentane-1,2,3,4-tetrol |
| SMILES | OC[C@]1(O)C[C@@](O)(CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H14O6/c8-2-6(12)1-7(13,3-9)5(11)4(6)10/h4-5,8-13H,1-3H2/t4-,5-,6+,7+/m0/s1 |
| InChIKey | PODABYJOLYLNJM-VWDOSNQTSA-N |
| XLogP | -3.44 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.18 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |