C46H39N2S+ — CID 176814707
3-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-[5-(trideuteriomethyl)-10-thiapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaen-8-yl]-1H-benzimidazol-3-ium (PubChem CID 176814707) has the molecular formula C46H39N2S+ and a molecular weight of 654.92 g/mol. Its IUPAC name is 3-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-[5-(trideuteriomethyl)-10-thiapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaen-8-yl]-1H-benzimidazol-3-ium.
| Compound Name | 3-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-[5-(trideuteriomethyl)-10-thiapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaen-8-yl]-1H-benzimidazol-3-ium |
|---|---|
| PubChem CID | 176814707 |
| Molecular Formula | C46H39N2S+ |
| Molecular Weight | 654.92 g/mol |
| Exact Mass | 654.30 |
| IUPAC Name | 3-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-[5-(trideuteriomethyl)-10-thiapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaen-8-yl]-1H-benzimidazol-3-ium |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2[nH]c3ccccc3[n+]2-c2c(C(C)C)cc(-c3ccccc3)cc2C(C)C)c2sc3cc4ccc5ccccc5c4cc3c12 |
| InChI | InChI=1S/C46H38N2S/c1-27(2)36-23-33(30-13-7-6-8-14-30)24-37(28(3)4)44(36)48-41-18-12-11-17-40(41)47-46(48)35-22-19-29(5)43-39-26-38-32(25-42(39)49-45(35)43)21-20-31-15-9-10-16-34(31)38/h6-28H,1-5H3/p+1/i5D3 |
| InChIKey | QGCUOZMEXUYCDC-VPYROQPTSA-O |
| XLogP | 13.01 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.92 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|