C13H23N2+ — CID 176815344
(4S,5R)-1-[(1R)-cyclohex-2-en-1-yl]-2,3,4,5-tetramethyl-4,5-dihydroimidazol-3-ium (PubChem CID 176815344) has the molecular formula C13H23N2+ and a molecular weight of 207.34 g/mol. Its IUPAC name is (4S,5R)-1-[(1R)-cyclohex-2-en-1-yl]-2,3,4,5-tetramethyl-4,5-dihydroimidazol-3-ium.
| Compound Name | (4S,5R)-1-[(1R)-cyclohex-2-en-1-yl]-2,3,4,5-tetramethyl-4,5-dihydroimidazol-3-ium |
|---|---|
| PubChem CID | 176815344 |
| Molecular Formula | C13H23N2+ |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.19 |
| IUPAC Name | (4S,5R)-1-[(1R)-cyclohex-2-en-1-yl]-2,3,4,5-tetramethyl-4,5-dihydroimidazol-3-ium |
| SMILES | CC1=[N+](C)[C@@H](C)[C@@H](C)N1[C@H]1C=CCCC1 |
| InChI | InChI=1S/C13H23N2/c1-10-11(2)15(12(3)14(10)4)13-8-6-5-7-9-13/h6,8,10-11,13H,5,7,9H2,1-4H3/q+1/t10-,11+,13-/m0/s1 |
| InChIKey | LLSCINCLLNCXNE-LOWVWBTDSA-N |
| XLogP | 2.25 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|