C12H21N2+ — CID 176815430
(4S)-1-[(1R)-cyclohex-2-en-1-yl]-2,3,4-trimethyl-4,5-dihydroimidazol-1-ium (PubChem CID 176815430) has the molecular formula C12H21N2+ and a molecular weight of 193.31 g/mol. Its IUPAC name is (4S)-1-[(1R)-cyclohex-2-en-1-yl]-2,3,4-trimethyl-4,5-dihydroimidazol-1-ium.
| Compound Name | (4S)-1-[(1R)-cyclohex-2-en-1-yl]-2,3,4-trimethyl-4,5-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 176815430 |
| Molecular Formula | C12H21N2+ |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.17 |
| IUPAC Name | (4S)-1-[(1R)-cyclohex-2-en-1-yl]-2,3,4-trimethyl-4,5-dihydroimidazol-1-ium |
| SMILES | CC1=[N+]([C@H]2C=CCCC2)C[C@H](C)N1C |
| InChI | InChI=1S/C12H21N2/c1-10-9-14(11(2)13(10)3)12-7-5-4-6-8-12/h5,7,10,12H,4,6,8-9H2,1-3H3/q+1/t10-,12-/m0/s1 |
| InChIKey | DMSFJBWCIHRGPN-JQWIXIFHSA-N |
| XLogP | 1.86 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|