About CID 176823412
CID 176823412 (PubChem CID 176823412) has the molecular formula C62H56IrN4O-2
and a molecular weight of 1074.43 g/mol.
Molecular Properties
| Compound Name | CID 176823412 |
| PubChem CID | 176823412 |
| Molecular Formula | C62H56IrN4O-2 |
| Molecular Weight | 1074.43 g/mol |
| Exact Mass | 1074.47 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2cc(C(C)(C)C)ccn2)cc1.[2H]C([2H])([2H])c1c[c-]c(-c2nc3cccc(C([2H])([2H])[2H])c3n2-c2c(C(C)C)cc(-c3ccccc3)cc2C(C)C)c2oc3nc4c(ccc5ccccc54)cc3c12.[Ir] |
| InChI | InChI=1S/C46H38N3O.C16H18N.Ir/c1-26(2)36-24-33(30-14-8-7-9-15-30)25-37(27(3)4)43(36)49-42-29(6)13-12-18-39(42)47-45(49)35-22-19-28(5)40-38-23-32-21-20-31-16-10-11-17-34(31)41(32)48-46(38)50-44(35)40;1-12-5-7-13(8-6-12)15-11-14(9-10-17-15)16(2,3)4;/h7-21,23-27H,1-6H3;5-7,9-11H,1-4H3;/q2*-1;/i5D3,6D3;1D3; |
| InChIKey | ZLHFIJIMQNPRAG-MWPHFZENSA-N |
| XLogP | 16.78 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 68 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1074.43 |
| LogP ≤ 5 | 16.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 176823412 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176823412?
The IUPAC name of CID 176823412 (CID 176823412) is not available.
What is the SMILES notation for CID 176823412?
The canonical SMILES for CID 176823412 is [2H]C([2H])([2H])c1c[c-]c(-c2cc(C(C)(C)C)ccn2)cc1.[2H]C([2H])([2H])c1c[c-]c(-c2nc3cccc(C([2H])([2H])[2H])c3n2-c2c(C(C)C)cc(-c3ccccc3)cc2C(C)C)c2oc3nc4c(ccc5ccccc54)cc3c12.[Ir].
What is the InChIKey of CID 176823412?
The InChIKey is ZLHFIJIMQNPRAG-MWPHFZENSA-N. The full InChI is InChI=1S/C46H38N3O.C16H18N.Ir/c1-26(2)36-24-33(30-14-8-7-9-15-30)25-37(27(3)4)43(36)49-42-29(6)13-12-18-39(42)47-45(49)35-22-19-28(5)40-38-23-32-21-20-31-16-10-11-17-34(31)41(32)48-46(38)50-44(35)40;1-12-5-7-13(8-6-12)15-11-14(9-10-17-15)16(2,3)4;/h7-21,23-27H,1-6H3;5-7,9-11H,1-4H3;/q2*-1;/i5D3,6D3;1D3;.
What are the key properties of CID 176823412?
CID 176823412 has a molecular weight of 1074.43 g/mol, XLogP of 16.78, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176823412 is sourced from PubChem (CID 176823412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).