C49H39N3 — CID 176825081
2-(1,3-dideuteriospiro[adamantane-2,9'-fluorene]-2'-yl)-4,6-bis(4-phenylphenyl)-1,3,5-triazine (PubChem CID 176825081) has the molecular formula C49H39N3 and a molecular weight of 671.88 g/mol. Its IUPAC name is 2-(1,3-dideuteriospiro[adamantane-2,9'-fluorene]-2'-yl)-4,6-bis(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-(1,3-dideuteriospiro[adamantane-2,9'-fluorene]-2'-yl)-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 176825081 |
| Molecular Formula | C49H39N3 |
| Molecular Weight | 671.88 g/mol |
| Exact Mass | 671.33 |
| IUPAC Name | 2-(1,3-dideuteriospiro[adamantane-2,9'-fluorene]-2'-yl)-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
| SMILES | [2H]C12CC3CC(C1)CC([2H])(C3)C21c2ccccc2-c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4ccc(-c5ccccc5)cc4)n3)cc21 |
| InChI | InChI=1S/C49H39N3/c1-3-9-33(10-4-1)35-15-19-37(20-16-35)46-50-47(38-21-17-36(18-22-38)34-11-5-2-6-12-34)52-48(51-46)39-23-24-43-42-13-7-8-14-44(42)49(45(43)30-39)40-26-31-25-32(28-40)29-41(49)27-31/h1-24,30-32,40-41H,25-29H2/i40D,41D |
| InChIKey | RGVDNDKKCXLRRE-SXDSJLLZSA-N |
| XLogP | 11.93 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.88 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |