C16H15N3O5 — CID 176831096
methyl (2R)-2-[(4-ethynyl-3,5-dihydroxybenzoyl)amino]-3-(1H-imidazol-5-yl)propanoate (PubChem CID 176831096) has the molecular formula C16H15N3O5 and a molecular weight of 329.31 g/mol. Its IUPAC name is methyl (2R)-2-[(4-ethynyl-3,5-dihydroxybenzoyl)amino]-3-(1H-imidazol-5-yl)propanoate.
| Compound Name | methyl (2R)-2-[(4-ethynyl-3,5-dihydroxybenzoyl)amino]-3-(1H-imidazol-5-yl)propanoate |
|---|---|
| PubChem CID | 176831096 |
| Molecular Formula | C16H15N3O5 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | methyl (2R)-2-[(4-ethynyl-3,5-dihydroxybenzoyl)amino]-3-(1H-imidazol-5-yl)propanoate |
| SMILES | C#Cc1c(O)cc(C(=O)N[C@H](Cc2cnc[nH]2)C(=O)OC)cc1O |
| InChI | InChI=1S/C16H15N3O5/c1-3-11-13(20)4-9(5-14(11)21)15(22)19-12(16(23)24-2)6-10-7-17-8-18-10/h1,4-5,7-8,12,20-21H,6H2,2H3,(H,17,18)(H,19,22)/t12-/m1/s1 |
| InChIKey | INVYUGOQWRYYIY-GFCCVEGCSA-N |
| XLogP | 0.32 |
| TPSA | 124.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|