C16H13N5O7 — CID 176831141
methyl (2R)-2-[(4-ethynyl-2,6-dinitrobenzoyl)amino]-3-(1H-imidazol-5-yl)propanoate (PubChem CID 176831141) has the molecular formula C16H13N5O7 and a molecular weight of 387.31 g/mol. Its IUPAC name is methyl (2R)-2-[(4-ethynyl-2,6-dinitrobenzoyl)amino]-3-(1H-imidazol-5-yl)propanoate.
| Compound Name | methyl (2R)-2-[(4-ethynyl-2,6-dinitrobenzoyl)amino]-3-(1H-imidazol-5-yl)propanoate |
|---|---|
| PubChem CID | 176831141 |
| Molecular Formula | C16H13N5O7 |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | methyl (2R)-2-[(4-ethynyl-2,6-dinitrobenzoyl)amino]-3-(1H-imidazol-5-yl)propanoate |
| SMILES | C#Cc1cc([N+](=O)[O-])c(C(=O)N[C@H](Cc2cnc[nH]2)C(=O)OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H13N5O7/c1-3-9-4-12(20(24)25)14(13(5-9)21(26)27)15(22)19-11(16(23)28-2)6-10-7-17-8-18-10/h1,4-5,7-8,11H,6H2,2H3,(H,17,18)(H,19,22)/t11-/m1/s1 |
| InChIKey | NYPIWSZOTHYKTL-LLVKDONJSA-N |
| XLogP | 0.72 |
| TPSA | 170.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|